About 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone
1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone (PubChem CID 10681939) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone |
| PubChem CID | 10681939 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone |
| SMILES | CC(=O)N1c2ccccc2C(O)C12CCC(C)O2 |
| InChI | InChI=1S/C14H17NO3/c1-9-7-8-14(18-9)13(17)11-5-3-4-6-12(11)15(14)10(2)16/h3-6,9,13,17H,7-8H2,1-2H3 |
| InChIKey | JCFWOUMZXSKKEI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone?
The IUPAC name of 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone (CID 10681939) is 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone.
What is the SMILES notation for 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone?
The canonical SMILES for 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone is CC(=O)N1c2ccccc2C(O)C12CCC(C)O2.
What is the InChIKey of 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone?
The InChIKey is JCFWOUMZXSKKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-9-7-8-14(18-9)13(17)11-5-3-4-6-12(11)15(14)10(2)16/h3-6,9,13,17H,7-8H2,1-2H3.
What are the key properties of 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone?
1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone has a molecular weight of 247.29 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-5'-methylspiro[3H-indole-2,2'-oxolane]-1-yl)ethanone is sourced from PubChem (CID 10681939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).