C5HF9O — CID 10681972
2-(difluoromethyl)-2,3,3,4,4,5,5-heptafluorooxolane (PubChem CID 10681972) has the molecular formula C5HF9O and a molecular weight of 248.04 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3,3,4,4,5,5-heptafluorooxolane.
| Compound Name | 2-(difluoromethyl)-2,3,3,4,4,5,5-heptafluorooxolane |
|---|---|
| PubChem CID | 10681972 |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.04 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-(difluoromethyl)-2,3,3,4,4,5,5-heptafluorooxolane |
| SMILES | FC(F)C1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF9O/c6-1(7)2(8)3(9,10)4(11,12)5(13,14)15-2/h1H |
| InChIKey | BGQHSXSZJLRYIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.04 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|