About 3-butyl-5-methyl-2,3-dihydro-1H-indole
3-butyl-5-methyl-2,3-dihydro-1H-indole (PubChem CID 106820126) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-butyl-5-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-butyl-5-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 106820126 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-butyl-5-methyl-2,3-dihydro-1H-indole |
| SMILES | CCCCC1CNc2ccc(C)cc21 |
| InChI | InChI=1S/C13H19N/c1-3-4-5-11-9-14-13-7-6-10(2)8-12(11)13/h6-8,11,14H,3-5,9H2,1-2H3 |
| InChIKey | RAOHPLHYDXHNKE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-5-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-5-methyl-2,3-dihydro-1H-indole?
The IUPAC name of 3-butyl-5-methyl-2,3-dihydro-1H-indole (CID 106820126) is 3-butyl-5-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-butyl-5-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for 3-butyl-5-methyl-2,3-dihydro-1H-indole is CCCCC1CNc2ccc(C)cc21.
What is the InChIKey of 3-butyl-5-methyl-2,3-dihydro-1H-indole?
The InChIKey is RAOHPLHYDXHNKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-3-4-5-11-9-14-13-7-6-10(2)8-12(11)13/h6-8,11,14H,3-5,9H2,1-2H3.
What are the key properties of 3-butyl-5-methyl-2,3-dihydro-1H-indole?
3-butyl-5-methyl-2,3-dihydro-1H-indole has a molecular weight of 189.30 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-5-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 106820126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).