About 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one
2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one (PubChem CID 10682027) has the molecular formula C14H16O2S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one |
| PubChem CID | 10682027 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one |
| SMILES | Cc1cc(C)c([S@](=O)C2=CCCC2=O)c(C)c1 |
| InChI | InChI=1S/C14H16O2S/c1-9-7-10(2)14(11(3)8-9)17(16)13-6-4-5-12(13)15/h6-8H,4-5H2,1-3H3/t17-/m1/s1 |
| InChIKey | CVTFGMOIWHQVAE-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one?
The IUPAC name of 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one (CID 10682027) is 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one.
What is the SMILES notation for 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one?
The canonical SMILES for 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one is Cc1cc(C)c([S@](=O)C2=CCCC2=O)c(C)c1.
What is the InChIKey of 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one?
The InChIKey is CVTFGMOIWHQVAE-QGZVFWFLSA-N. The full InChI is InChI=1S/C14H16O2S/c1-9-7-10(2)14(11(3)8-9)17(16)13-6-4-5-12(13)15/h6-8H,4-5H2,1-3H3/t17-/m1/s1.
What are the key properties of 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one?
2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one has a molecular weight of 248.35 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(S)-(2,4,6-trimethylphenyl)sulfinyl]cyclopent-2-en-1-one is sourced from PubChem (CID 10682027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).