C18H27N3 — CID 106820720
(4aS,7aS)-6-(1-phenylpiperidin-4-yl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 106820720) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (4aS,7aS)-6-(1-phenylpiperidin-4-yl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(1-phenylpiperidin-4-yl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 106820720 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (4aS,7aS)-6-(1-phenylpiperidin-4-yl)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | c1ccc(N2CCC(N3C[C@@H]4CCCN[C@@H]4C3)CC2)cc1 |
| InChI | InChI=1S/C18H27N3/c1-2-6-16(7-3-1)20-11-8-17(9-12-20)21-13-15-5-4-10-19-18(15)14-21/h1-3,6-7,15,17-19H,4-5,8-14H2/t15-,18+/m0/s1 |
| InChIKey | IGEWXGBBKGRVEQ-MAUKXSAKSA-N |
| XLogP | 2.34 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |