C16H25NO3S — CID 106820916
4-(3-ethylsulfonylpropyl)-1-phenylpiperidin-4-ol (PubChem CID 106820916) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 4-(3-ethylsulfonylpropyl)-1-phenylpiperidin-4-ol.
| Compound Name | 4-(3-ethylsulfonylpropyl)-1-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 106820916 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-(3-ethylsulfonylpropyl)-1-phenylpiperidin-4-ol |
| SMILES | CCS(=O)(=O)CCCC1(O)CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H25NO3S/c1-2-21(19,20)14-6-9-16(18)10-12-17(13-11-16)15-7-4-3-5-8-15/h3-5,7-8,18H,2,6,9-14H2,1H3 |
| InChIKey | NIKLIGBDFUGYPV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |