C17H15FN2 — CID 106821098
8-fluoro-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 106821098) has the molecular formula C17H15FN2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 8-fluoro-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-fluoro-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 106821098 |
| Molecular Formula | C17H15FN2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 8-fluoro-2-phenyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Fc1ccc2[nH]c3c(c2c1)CN(c1ccccc1)CC3 |
| InChI | InChI=1S/C17H15FN2/c18-12-6-7-16-14(10-12)15-11-20(9-8-17(15)19-16)13-4-2-1-3-5-13/h1-7,10,19H,8-9,11H2 |
| InChIKey | NILLVLZHTBRKHJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|