C13H17N3O — CID 106821114
8-phenyl-1-oxa-3,8-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 106821114) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 8-phenyl-1-oxa-3,8-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 8-phenyl-1-oxa-3,8-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 106821114 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 8-phenyl-1-oxa-3,8-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | NC1=NCC2(CCN(c3ccccc3)CC2)O1 |
| InChI | InChI=1S/C13H17N3O/c14-12-15-10-13(17-12)6-8-16(9-7-13)11-4-2-1-3-5-11/h1-5H,6-10H2,(H2,14,15) |
| InChIKey | HIPBUQHZLACGOI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |