About 8-(3-nitrophenyl)-1,7-naphthyridine
8-(3-nitrophenyl)-1,7-naphthyridine (PubChem CID 10682163) has the molecular formula C14H9N3O2
and a molecular weight of 251.25 g/mol. Its IUPAC name is 8-(3-nitrophenyl)-1,7-naphthyridine.
Molecular Properties
| Compound Name | 8-(3-nitrophenyl)-1,7-naphthyridine |
| PubChem CID | 10682163 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 8-(3-nitrophenyl)-1,7-naphthyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2nccc3cccnc23)c1 |
| InChI | InChI=1S/C14H9N3O2/c18-17(19)12-5-1-3-11(9-12)14-13-10(6-8-16-14)4-2-7-15-13/h1-9H |
| InChIKey | OMRFTRYPQRVACI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-nitrophenyl)-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-nitrophenyl)-1,7-naphthyridine?
The IUPAC name of 8-(3-nitrophenyl)-1,7-naphthyridine (CID 10682163) is 8-(3-nitrophenyl)-1,7-naphthyridine.
What is the SMILES notation for 8-(3-nitrophenyl)-1,7-naphthyridine?
The canonical SMILES for 8-(3-nitrophenyl)-1,7-naphthyridine is O=[N+]([O-])c1cccc(-c2nccc3cccnc23)c1.
What is the InChIKey of 8-(3-nitrophenyl)-1,7-naphthyridine?
The InChIKey is OMRFTRYPQRVACI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2/c18-17(19)12-5-1-3-11(9-12)14-13-10(6-8-16-14)4-2-7-15-13/h1-9H.
What are the key properties of 8-(3-nitrophenyl)-1,7-naphthyridine?
8-(3-nitrophenyl)-1,7-naphthyridine has a molecular weight of 251.25 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-nitrophenyl)-1,7-naphthyridine is sourced from PubChem (CID 10682163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).