C10H20N2O — CID 106822130
1-(aminomethyl)-3-ethoxy-N-prop-2-enylcyclobutan-1-amine (PubChem CID 106822130) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(aminomethyl)-3-ethoxy-N-prop-2-enylcyclobutan-1-amine.
| Compound Name | 1-(aminomethyl)-3-ethoxy-N-prop-2-enylcyclobutan-1-amine |
|---|---|
| PubChem CID | 106822130 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(aminomethyl)-3-ethoxy-N-prop-2-enylcyclobutan-1-amine |
| SMILES | C=CCNC1(CN)CC(OCC)C1 |
| InChI | InChI=1S/C10H20N2O/c1-3-5-12-10(8-11)6-9(7-10)13-4-2/h3,9,12H,1,4-8,11H2,2H3 |
| InChIKey | HJGXGUMMMJNEJZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|