C11H21NO3 — CID 106822542
methyl 3-ethoxy-1-(propan-2-ylamino)cyclobutane-1-carboxylate (PubChem CID 106822542) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 3-ethoxy-1-(propan-2-ylamino)cyclobutane-1-carboxylate.
| Compound Name | methyl 3-ethoxy-1-(propan-2-ylamino)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 106822542 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl 3-ethoxy-1-(propan-2-ylamino)cyclobutane-1-carboxylate |
| SMILES | CCOC1CC(NC(C)C)(C(=O)OC)C1 |
| InChI | InChI=1S/C11H21NO3/c1-5-15-9-6-11(7-9,10(13)14-4)12-8(2)3/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | UPYJNEKILVOFML-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |