C15H23NO3 — CID 106825399
[4-[(4-methoxy-6-methyl-2-pyridinyl)methoxy]cyclohexyl]methanol (PubChem CID 106825399) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is [4-[(4-methoxy-6-methyl-2-pyridinyl)methoxy]cyclohexyl]methanol.
| Compound Name | [4-[(4-methoxy-6-methyl-2-pyridinyl)methoxy]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106825399 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [4-[(4-methoxy-6-methyl-2-pyridinyl)methoxy]cyclohexyl]methanol |
| SMILES | COc1cc(C)nc(COC2CCC(CO)CC2)c1 |
| InChI | InChI=1S/C15H23NO3/c1-11-7-15(18-2)8-13(16-11)10-19-14-5-3-12(9-17)4-6-14/h7-8,12,14,17H,3-6,9-10H2,1-2H3 |
| InChIKey | OQHUJFXTPFXTJJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |