About [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol
[4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol (PubChem CID 106825527) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol |
| PubChem CID | 106825527 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol |
| SMILES | OCC1CCC(OCc2ncon2)CC1 |
| InChI | InChI=1S/C10H16N2O3/c13-5-8-1-3-9(4-2-8)14-6-10-11-7-15-12-10/h7-9,13H,1-6H2 |
| InChIKey | ZZEMKEQAUYNHIA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol?
The IUPAC name of [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol (CID 106825527) is [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol.
What is the SMILES notation for [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol?
The canonical SMILES for [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol is OCC1CCC(OCc2ncon2)CC1.
What is the InChIKey of [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol?
The InChIKey is ZZEMKEQAUYNHIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c13-5-8-1-3-9(4-2-8)14-6-10-11-7-15-12-10/h7-9,13H,1-6H2.
What are the key properties of [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol?
[4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol has a molecular weight of 212.25 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2,4-oxadiazol-3-ylmethoxy)cyclohexyl]methanol is sourced from PubChem (CID 106825527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).