C12H16ClNO2 — CID 106825756
[4-[(5-chloro-2-pyridinyl)oxy]cyclohexyl]methanol (PubChem CID 106825756) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is [4-[(5-chloro-2-pyridinyl)oxy]cyclohexyl]methanol.
| Compound Name | [4-[(5-chloro-2-pyridinyl)oxy]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106825756 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [4-[(5-chloro-2-pyridinyl)oxy]cyclohexyl]methanol |
| SMILES | OCC1CCC(Oc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C12H16ClNO2/c13-10-3-6-12(14-7-10)16-11-4-1-9(8-15)2-5-11/h3,6-7,9,11,15H,1-2,4-5,8H2 |
| InChIKey | ZJQCCGJBYYFLOF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |