C14H25NO3 — CID 106826432
2-methyl-5-[(1-methylcyclohexanecarbonyl)amino]pentanoic acid (PubChem CID 106826432) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-methyl-5-[(1-methylcyclohexanecarbonyl)amino]pentanoic acid.
| Compound Name | 2-methyl-5-[(1-methylcyclohexanecarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 106826432 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-methyl-5-[(1-methylcyclohexanecarbonyl)amino]pentanoic acid |
| SMILES | CC(CCCNC(=O)C1(C)CCCCC1)C(=O)O |
| InChI | InChI=1S/C14H25NO3/c1-11(12(16)17)7-6-10-15-13(18)14(2)8-4-3-5-9-14/h11H,3-10H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | LEWMVDMIJMBCBC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|