C14H30O2Si — CID 10682670
(Z,3S,5S,8S)-2,2-dimethyl-8-trimethylsilylnon-6-ene-3,5-diol (PubChem CID 10682670) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (Z,3S,5S,8S)-2,2-dimethyl-8-trimethylsilylnon-6-ene-3,5-diol.
| Compound Name | (Z,3S,5S,8S)-2,2-dimethyl-8-trimethylsilylnon-6-ene-3,5-diol |
|---|---|
| PubChem CID | 10682670 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (Z,3S,5S,8S)-2,2-dimethyl-8-trimethylsilylnon-6-ene-3,5-diol |
| SMILES | C[C@@H](/C=C\[C@@H](O)C[C@H](O)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-11(17(5,6)7)8-9-12(15)10-13(16)14(2,3)4/h8-9,11-13,15-16H,10H2,1-7H3/b9-8-/t11-,12+,13-/m0/s1 |
| InChIKey | NVVHWDYULOIJLV-ZZABBREVSA-N |
| XLogP | 3.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|