C11H24N2 — CID 106827234
2-N-[(1-methylcyclohexyl)methyl]propane-1,2-diamine (PubChem CID 106827234) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2-N-[(1-methylcyclohexyl)methyl]propane-1,2-diamine.
| Compound Name | 2-N-[(1-methylcyclohexyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 106827234 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2-N-[(1-methylcyclohexyl)methyl]propane-1,2-diamine |
| SMILES | CC(CN)NCC1(C)CCCCC1 |
| InChI | InChI=1S/C11H24N2/c1-10(8-12)13-9-11(2)6-4-3-5-7-11/h10,13H,3-9,12H2,1-2H3 |
| InChIKey | FVHVGRALOBMSMG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |