About 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine
5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine (PubChem CID 106829181) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine |
| PubChem CID | 106829181 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine |
| SMILES | CC1(c2nc(N)ns2)CCCCC1 |
| InChI | InChI=1S/C9H15N3S/c1-9(5-3-2-4-6-9)7-11-8(10)12-13-7/h2-6H2,1H3,(H2,10,12) |
| InChIKey | GUHFPMMROHZFIM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine?
The IUPAC name of 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine (CID 106829181) is 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine.
What is the SMILES notation for 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine?
The canonical SMILES for 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine is CC1(c2nc(N)ns2)CCCCC1.
What is the InChIKey of 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine?
The InChIKey is GUHFPMMROHZFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-9(5-3-2-4-6-9)7-11-8(10)12-13-7/h2-6H2,1H3,(H2,10,12).
What are the key properties of 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine?
5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine has a molecular weight of 197.31 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methylcyclohexyl)-1,2,4-thiadiazol-3-amine is sourced from PubChem (CID 106829181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).