C12H19BrN2S — CID 106829272
2-(1-bromopropyl)-5-(1-methylcyclohexyl)-1,3,4-thiadiazole (PubChem CID 106829272) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-(1-bromopropyl)-5-(1-methylcyclohexyl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-bromopropyl)-5-(1-methylcyclohexyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 106829272 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(1-bromopropyl)-5-(1-methylcyclohexyl)-1,3,4-thiadiazole |
| SMILES | CCC(Br)c1nnc(C2(C)CCCCC2)s1 |
| InChI | InChI=1S/C12H19BrN2S/c1-3-9(13)10-14-15-11(16-10)12(2)7-5-4-6-8-12/h9H,3-8H2,1-2H3 |
| InChIKey | PFLGAYVREBLTML-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|