About (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol
(E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol (PubChem CID 10683051) has the molecular formula C12H19F3OSi
and a molecular weight of 264.36 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol.
Molecular Properties
| Compound Name | (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol |
| PubChem CID | 10683051 |
| Molecular Formula | C12H19F3OSi |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol |
| SMILES | CCCC(O)/C(C#C[Si](C)(C)C)=C/C(F)(F)F |
| InChI | InChI=1S/C12H19F3OSi/c1-5-6-11(16)10(9-12(13,14)15)7-8-17(2,3)4/h9,11,16H,5-6H2,1-4H3/b10-9+ |
| InChIKey | GJLNCXLCYBKVPX-MDZDMXLPSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol?
The IUPAC name of (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol (CID 10683051) is (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol.
What is the SMILES notation for (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol?
The canonical SMILES for (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol is CCCC(O)/C(C#C[Si](C)(C)C)=C/C(F)(F)F.
What is the InChIKey of (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol?
The InChIKey is GJLNCXLCYBKVPX-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H19F3OSi/c1-5-6-11(16)10(9-12(13,14)15)7-8-17(2,3)4/h9,11,16H,5-6H2,1-4H3/b10-9+.
What are the key properties of (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol?
(E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol has a molecular weight of 264.36 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,1-trifluoro-3-(2-trimethylsilylethynyl)hept-2-en-4-ol is sourced from PubChem (CID 10683051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).