C13H22N2O — CID 106830881
(2-ethylpyrazol-3-yl)-(1-methylcyclohexyl)methanol (PubChem CID 106830881) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl)-(1-methylcyclohexyl)methanol.
| Compound Name | (2-ethylpyrazol-3-yl)-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106830881 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (2-ethylpyrazol-3-yl)-(1-methylcyclohexyl)methanol |
| SMILES | CCn1nccc1C(O)C1(C)CCCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-3-15-11(7-10-14-15)12(16)13(2)8-5-4-6-9-13/h7,10,12,16H,3-6,8-9H2,1-2H3 |
| InChIKey | HDMLUXQWNHPJPY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |