C16H14N2S — CID 10683193
4-methyl-2-[phenyl(pyridin-2-yl)methyl]-1,3-thiazole (PubChem CID 10683193) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 4-methyl-2-[phenyl(pyridin-2-yl)methyl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[phenyl(pyridin-2-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 10683193 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-methyl-2-[phenyl(pyridin-2-yl)methyl]-1,3-thiazole |
| SMILES | Cc1csc(C(c2ccccc2)c2ccccn2)n1 |
| InChI | InChI=1S/C16H14N2S/c1-12-11-19-16(18-12)15(13-7-3-2-4-8-13)14-9-5-6-10-17-14/h2-11,15H,1H3 |
| InChIKey | UZLNMHBCPZWZPE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |