C13H20N2OS — CID 106832426
6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylhexanenitrile (PubChem CID 106832426) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106832426 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylhexanenitrile |
| SMILES | Cc1nc(SCCCCC(C)(C)C#N)oc1C |
| InChI | InChI=1S/C13H20N2OS/c1-10-11(2)16-12(15-10)17-8-6-5-7-13(3,4)9-14/h5-8H2,1-4H3 |
| InChIKey | BRLJHIVVHWPPOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|