C11H17N3S — CID 106832428
6-(1H-imidazol-2-ylsulfanyl)-2,2-dimethylhexanenitrile (PubChem CID 106832428) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 6-(1H-imidazol-2-ylsulfanyl)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(1H-imidazol-2-ylsulfanyl)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106832428 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 6-(1H-imidazol-2-ylsulfanyl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCSc1ncc[nH]1 |
| InChI | InChI=1S/C11H17N3S/c1-11(2,9-12)5-3-4-8-15-10-13-6-7-14-10/h6-7H,3-5,8H2,1-2H3,(H,13,14) |
| InChIKey | CSCUOICOSWXNDZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|