C10H12N6O2 — CID 106832693
1,3-dimethyl-4-nitro-N-(pyridazin-3-ylmethyl)pyrazol-5-amine (PubChem CID 106832693) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 1,3-dimethyl-4-nitro-N-(pyridazin-3-ylmethyl)pyrazol-5-amine.
| Compound Name | 1,3-dimethyl-4-nitro-N-(pyridazin-3-ylmethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 106832693 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1,3-dimethyl-4-nitro-N-(pyridazin-3-ylmethyl)pyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCc2cccnn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N6O2/c1-7-9(16(17)18)10(15(2)14-7)11-6-8-4-3-5-12-13-8/h3-5,11H,6H2,1-2H3 |
| InChIKey | MQIJCRBBGYSLGM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|