C16H15NO3 — CID 10683394
(1-acetyl-2,3-dihydrobenzo[g]indol-5-yl) acetate (PubChem CID 10683394) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (1-acetyl-2,3-dihydrobenzo[g]indol-5-yl) acetate.
| Compound Name | (1-acetyl-2,3-dihydrobenzo[g]indol-5-yl) acetate |
|---|---|
| PubChem CID | 10683394 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (1-acetyl-2,3-dihydrobenzo[g]indol-5-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)N(C(C)=O)CC2 |
| InChI | InChI=1S/C16H15NO3/c1-10(18)17-8-7-12-9-15(20-11(2)19)13-5-3-4-6-14(13)16(12)17/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | KFLKALRCGSVZDF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|