C15H13BrClNO2 — CID 106834696
2-bromo-5-chloro-N-(4-hydroxy-2,5-dimethylphenyl)benzamide (PubChem CID 106834696) has the molecular formula C15H13BrClNO2 and a molecular weight of 354.63 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-(4-hydroxy-2,5-dimethylphenyl)benzamide.
| Compound Name | 2-bromo-5-chloro-N-(4-hydroxy-2,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 106834696 |
| Molecular Formula | C15H13BrClNO2 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 2-bromo-5-chloro-N-(4-hydroxy-2,5-dimethylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cc(Cl)ccc2Br)c(C)cc1O |
| InChI | InChI=1S/C15H13BrClNO2/c1-8-6-14(19)9(2)5-13(8)18-15(20)11-7-10(17)3-4-12(11)16/h3-7,19H,1-2H3,(H,18,20) |
| InChIKey | TWHVZOFGJRJUGR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|