C14H13N3O3 — CID 10683508
3-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)pyrrolidine-2,5-dione (PubChem CID 10683508) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10683508 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1C1CC(=O)NC1=O |
| InChI | InChI=1S/C14H13N3O3/c1-8-12(10-7-11(18)15-13(10)19)14(20)17(16-8)9-5-3-2-4-6-9/h2-6,10,12H,7H2,1H3,(H,15,18,19) |
| InChIKey | LXSSDCLNOUVJHB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|