C16H27N3O2 — CID 106835333
1-[1-[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]piperidin-4-yl]ethanol (PubChem CID 106835333) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[1-[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106835333 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-[1-[5-amino-6-[(2-methylpropan-2-yl)oxy]-2-pyridinyl]piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(c2ccc(N)c(OC(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-11(20)12-7-9-19(10-8-12)14-6-5-13(17)15(18-14)21-16(2,3)4/h5-6,11-12,20H,7-10,17H2,1-4H3 |
| InChIKey | CNGKNLMZSSOZSR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |