C16H20BrN3O — CID 106835353
1-[1-(3-amino-6-bromoquinolin-4-yl)piperidin-4-yl]ethanol (PubChem CID 106835353) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is 1-[1-(3-amino-6-bromoquinolin-4-yl)piperidin-4-yl]ethanol.
| Compound Name | 1-[1-(3-amino-6-bromoquinolin-4-yl)piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106835353 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-[1-(3-amino-6-bromoquinolin-4-yl)piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(c2c(N)cnc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C16H20BrN3O/c1-10(21)11-4-6-20(7-5-11)16-13-8-12(17)2-3-15(13)19-9-14(16)18/h2-3,8-11,21H,4-7,18H2,1H3 |
| InChIKey | WROIDHCSLRPAAR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |