C15H22FN3O2 — CID 106836113
5-fluoro-N'-hydroxy-2-[[4-(1-hydroxyethyl)piperidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 106836113) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-[[4-(1-hydroxyethyl)piperidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-[[4-(1-hydroxyethyl)piperidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106836113 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-[[4-(1-hydroxyethyl)piperidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | CC(O)C1CCN(Cc2ccc(F)cc2/C(N)=N/O)CC1 |
| InChI | InChI=1S/C15H22FN3O2/c1-10(20)11-4-6-19(7-5-11)9-12-2-3-13(16)8-14(12)15(17)18-21/h2-3,8,10-11,20-21H,4-7,9H2,1H3,(H2,17,18) |
| InChIKey | VALOSOYICFCSFU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|