C16H19NO3 — CID 10683663
methyl (1R,2S,3R,5R)-3-hydroxy-3-methyl-2-phenyl-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 10683663) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl (1R,2S,3R,5R)-3-hydroxy-3-methyl-2-phenyl-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | methyl (1R,2S,3R,5R)-3-hydroxy-3-methyl-2-phenyl-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 10683663 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl (1R,2S,3R,5R)-3-hydroxy-3-methyl-2-phenyl-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | COC(=O)N1[C@@H]2C=C[C@H]1C[C@@](C)(O)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-16(19)10-12-8-9-13(17(12)15(18)20-2)14(16)11-6-4-3-5-7-11/h3-9,12-14,19H,10H2,1-2H3/t12-,13+,14-,16+/m0/s1 |
| InChIKey | IKMKRNZTOBJMER-KNCOVGOOSA-N |
| XLogP | 2.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|