About 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane
3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane (PubChem CID 10683697) has the molecular formula C13H13F3O3
and a molecular weight of 274.24 g/mol. Its IUPAC name is 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane.
Molecular Properties
| Compound Name | 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane |
| PubChem CID | 10683697 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane |
| SMILES | C=C(C)C1(C)OOC(c2ccccc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C13H13F3O3/c1-9(2)11(3)17-12(19-18-11,13(14,15)16)10-7-5-4-6-8-10/h4-8H,1H2,2-3H3 |
| InChIKey | KSOBIMKZJMCCKP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane?
The IUPAC name of 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane (CID 10683697) is 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane.
What is the SMILES notation for 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane?
The canonical SMILES for 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane is C=C(C)C1(C)OOC(c2ccccc2)(C(F)(F)F)O1.
What is the InChIKey of 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane?
The InChIKey is KSOBIMKZJMCCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3O3/c1-9(2)11(3)17-12(19-18-11,13(14,15)16)10-7-5-4-6-8-10/h4-8H,1H2,2-3H3.
What are the key properties of 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane?
3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane has a molecular weight of 274.24 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-phenyl-3-prop-1-en-2-yl-5-(trifluoromethyl)-1,2,4-trioxolane is sourced from PubChem (CID 10683697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).