C13H19FO5 — CID 10683707
(1R,3R,7R,9R)-7-(fluoromethyl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one (PubChem CID 10683707) has the molecular formula C13H19FO5 and a molecular weight of 274.29 g/mol. Its IUPAC name is (1R,3R,7R,9R)-7-(fluoromethyl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one.
| Compound Name | (1R,3R,7R,9R)-7-(fluoromethyl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
|---|---|
| PubChem CID | 10683707 |
| Molecular Formula | C13H19FO5 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (1R,3R,7R,9R)-7-(fluoromethyl)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
| SMILES | CC1(C)O[C@@H]2C[C@@]3(CF)OC(C)(C)O[C@H]3C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H19FO5/c1-11(2)16-7-5-13(6-14)10(8(15)9(7)17-11)18-12(3,4)19-13/h7,9-10H,5-6H2,1-4H3/t7-,9-,10+,13+/m1/s1 |
| InChIKey | GLXJFNKIBFRBAY-PZWLIILKSA-N |
| XLogP | 1.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |