About 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol
1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol (PubChem CID 106837465) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol.
Molecular Properties
| Compound Name | 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol |
| PubChem CID | 106837465 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NO/c1-9(16)10-3-7-15(8-4-10)6-2-5-11(12,13)14/h9-10,16H,2-8H2,1H3 |
| InChIKey | MTNXRDDMOAKPQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol?
The IUPAC name of 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol (CID 106837465) is 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol.
What is the SMILES notation for 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol?
The canonical SMILES for 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol is CC(O)C1CCN(CCCC(F)(F)F)CC1.
What is the InChIKey of 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol?
The InChIKey is MTNXRDDMOAKPQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-9(16)10-3-7-15(8-4-10)6-2-5-11(12,13)14/h9-10,16H,2-8H2,1H3.
What are the key properties of 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol?
1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol has a molecular weight of 239.28 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]ethanol is sourced from PubChem (CID 106837465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).