About 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol
1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol (PubChem CID 106837645) has the molecular formula C14H25N3OS
and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol.
Molecular Properties
| Compound Name | 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol |
| PubChem CID | 106837645 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol |
| SMILES | CCCNc1ncc(CN2CCC(C(C)O)CC2)s1 |
| InChI | InChI=1S/C14H25N3OS/c1-3-6-15-14-16-9-13(19-14)10-17-7-4-12(5-8-17)11(2)18/h9,11-12,18H,3-8,10H2,1-2H3,(H,15,16) |
| InChIKey | XZUSIXGMDFSPBG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol?
The IUPAC name of 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol (CID 106837645) is 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol.
What is the SMILES notation for 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol?
The canonical SMILES for 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol is CCCNc1ncc(CN2CCC(C(C)O)CC2)s1.
What is the InChIKey of 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol?
The InChIKey is XZUSIXGMDFSPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3OS/c1-3-6-15-14-16-9-13(19-14)10-17-7-4-12(5-8-17)11(2)18/h9,11-12,18H,3-8,10H2,1-2H3,(H,15,16).
What are the key properties of 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol?
1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol has a molecular weight of 283.44 g/mol, XLogP of 2.56, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]piperidin-4-yl]ethanol is sourced from PubChem (CID 106837645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).