C13H22ClN3 — CID 106838160
4-(1-chloroethyl)-1-[2-(2-methylimidazol-1-yl)ethyl]piperidine (PubChem CID 106838160) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-[2-(2-methylimidazol-1-yl)ethyl]piperidine.
| Compound Name | 4-(1-chloroethyl)-1-[2-(2-methylimidazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 106838160 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-(1-chloroethyl)-1-[2-(2-methylimidazol-1-yl)ethyl]piperidine |
| SMILES | Cc1nccn1CCN1CCC(C(C)Cl)CC1 |
| InChI | InChI=1S/C13H22ClN3/c1-11(14)13-3-6-16(7-4-13)9-10-17-8-5-15-12(17)2/h5,8,11,13H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | WQZXANPQLHUHOU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|