C16H22ClN — CID 106838163
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(1-chloroethyl)piperidine (PubChem CID 106838163) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(1-chloroethyl)piperidine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(1-chloroethyl)piperidine |
|---|---|
| PubChem CID | 106838163 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(1-chloroethyl)piperidine |
| SMILES | CC(Cl)C1CCN(CC2Cc3ccccc32)CC1 |
| InChI | InChI=1S/C16H22ClN/c1-12(17)13-6-8-18(9-7-13)11-15-10-14-4-2-3-5-16(14)15/h2-5,12-13,15H,6-11H2,1H3 |
| InChIKey | JNJWTWSDFKZEOH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|