C14H22BrN3O — CID 106838630
2-[4-(1-bromoethyl)piperidin-1-yl]-4-propan-2-yloxypyrimidine (PubChem CID 106838630) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-[4-(1-bromoethyl)piperidin-1-yl]-4-propan-2-yloxypyrimidine.
| Compound Name | 2-[4-(1-bromoethyl)piperidin-1-yl]-4-propan-2-yloxypyrimidine |
|---|---|
| PubChem CID | 106838630 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[4-(1-bromoethyl)piperidin-1-yl]-4-propan-2-yloxypyrimidine |
| SMILES | CC(C)Oc1ccnc(N2CCC(C(C)Br)CC2)n1 |
| InChI | InChI=1S/C14H22BrN3O/c1-10(2)19-13-4-7-16-14(17-13)18-8-5-12(6-9-18)11(3)15/h4,7,10-12H,5-6,8-9H2,1-3H3 |
| InChIKey | SYHJRMWDQLYIEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|