About 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene
8-diethoxyphosphoryl-2,6-dimethyloct-2-ene (PubChem CID 10683877) has the molecular formula C14H29O3P
and a molecular weight of 276.36 g/mol. Its IUPAC name is 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene |
| PubChem CID | 10683877 |
| Molecular Formula | C14H29O3P |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene |
| SMILES | CCOP(=O)(CCC(C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C14H29O3P/c1-6-16-18(15,17-7-2)12-11-14(5)10-8-9-13(3)4/h9,14H,6-8,10-12H2,1-5H3 |
| InChIKey | XLCKBWPTYBZYFP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene?
The IUPAC name of 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene (CID 10683877) is 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene.
What is the SMILES notation for 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene?
The canonical SMILES for 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene is CCOP(=O)(CCC(C)CCC=C(C)C)OCC.
What is the InChIKey of 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene?
The InChIKey is XLCKBWPTYBZYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29O3P/c1-6-16-18(15,17-7-2)12-11-14(5)10-8-9-13(3)4/h9,14H,6-8,10-12H2,1-5H3.
What are the key properties of 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene?
8-diethoxyphosphoryl-2,6-dimethyloct-2-ene has a molecular weight of 276.36 g/mol, XLogP of 5.03, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-diethoxyphosphoryl-2,6-dimethyloct-2-ene is sourced from PubChem (CID 10683877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).