C16H22O4 — CID 10683995
(2Z,4E)-5-[(1R,2R,6S)-2-hydroxy-1,3,3-trimethyl-5-oxo-2-bicyclo[4.1.0]heptanyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 10683995) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2Z,4E)-5-[(1R,2R,6S)-2-hydroxy-1,3,3-trimethyl-5-oxo-2-bicyclo[4.1.0]heptanyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1R,2R,6S)-2-hydroxy-1,3,3-trimethyl-5-oxo-2-bicyclo[4.1.0]heptanyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10683995 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (2Z,4E)-5-[(1R,2R,6S)-2-hydroxy-1,3,3-trimethyl-5-oxo-2-bicyclo[4.1.0]heptanyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/[C@@]1(O)C(C)(C)CC(=O)[C@H]2C[C@]21C |
| InChI | InChI=1S/C16H22O4/c1-10(7-13(18)19)5-6-16(20)14(2,3)9-12(17)11-8-15(11,16)4/h5-7,11,20H,8-9H2,1-4H3,(H,18,19)/b6-5+,10-7-/t11-,15-,16-/m1/s1 |
| InChIKey | AGQVXVBJROIHJH-HKWCUMPRSA-N |
| XLogP | 2.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|