C13H18N2O2 — CID 106840557
5-[(4-hydroxybutylamino)methyl]-2-methoxybenzonitrile (PubChem CID 106840557) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-[(4-hydroxybutylamino)methyl]-2-methoxybenzonitrile.
| Compound Name | 5-[(4-hydroxybutylamino)methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 106840557 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5-[(4-hydroxybutylamino)methyl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(CNCCCCO)cc1C#N |
| InChI | InChI=1S/C13H18N2O2/c1-17-13-5-4-11(8-12(13)9-14)10-15-6-2-3-7-16/h4-5,8,15-16H,2-3,6-7,10H2,1H3 |
| InChIKey | HEUVDSOTOQKUCZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|