C13H21N3O4S — CID 106842322
N'-hydroxy-4-[2-(4-hydroxybutylamino)ethylsulfonyl]benzenecarboximidamide (PubChem CID 106842322) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is N'-hydroxy-4-[2-(4-hydroxybutylamino)ethylsulfonyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[2-(4-hydroxybutylamino)ethylsulfonyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106842322 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N'-hydroxy-4-[2-(4-hydroxybutylamino)ethylsulfonyl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(S(=O)(=O)CCNCCCCO)cc1 |
| InChI | InChI=1S/C13H21N3O4S/c14-13(16-18)11-3-5-12(6-4-11)21(19,20)10-8-15-7-1-2-9-17/h3-6,15,17-18H,1-2,7-10H2,(H2,14,16) |
| InChIKey | OJBVNJMUYIBYQH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|