C11H15N3OS — CID 106842572
4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol (PubChem CID 106842572) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol.
| Compound Name | 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106842572 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol |
| SMILES | Cc1csc2c(NCCCCO)ncnc12 |
| InChI | InChI=1S/C11H15N3OS/c1-8-6-16-10-9(8)13-7-14-11(10)12-4-2-3-5-15/h6-7,15H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | DGVMCGPYTJFONK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|