About 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol
4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol (PubChem CID 106842572) has the molecular formula C11H15N3OS
and a molecular weight of 237.33 g/mol. Its IUPAC name is 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol.
Molecular Properties
| Compound Name | 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol |
| PubChem CID | 106842572 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol |
| SMILES | Cc1csc2c(NCCCCO)ncnc12 |
| InChI | InChI=1S/C11H15N3OS/c1-8-6-16-10-9(8)13-7-14-11(10)12-4-2-3-5-15/h6-7,15H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | DGVMCGPYTJFONK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol?
The IUPAC name of 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol (CID 106842572) is 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol.
What is the SMILES notation for 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol?
The canonical SMILES for 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol is Cc1csc2c(NCCCCO)ncnc12.
What is the InChIKey of 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol?
The InChIKey is DGVMCGPYTJFONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS/c1-8-6-16-10-9(8)13-7-14-11(10)12-4-2-3-5-15/h6-7,15H,2-5H2,1H3,(H,12,13,14).
What are the key properties of 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol?
4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol has a molecular weight of 237.33 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]butan-1-ol is sourced from PubChem (CID 106842572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).