C13H18N2O3S — CID 10684306
S-[(3S,5S,9S)-9-methyl-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl] ethanethioate (PubChem CID 10684306) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is S-[(3S,5S,9S)-9-methyl-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl] ethanethioate.
| Compound Name | S-[(3S,5S,9S)-9-methyl-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl] ethanethioate |
|---|---|
| PubChem CID | 10684306 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | S-[(3S,5S,9S)-9-methyl-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1C[C@H]2C(=O)N3CCC[C@@]3(C)C(=O)N2C1 |
| InChI | InChI=1S/C13H18N2O3S/c1-8(16)19-9-6-10-11(17)15-5-3-4-13(15,2)12(18)14(10)7-9/h9-10H,3-7H2,1-2H3/t9-,10-,13-/m0/s1 |
| InChIKey | JLMXFUZEICWNEW-KWBADKCTSA-N |
| XLogP | 0.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|