About 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one
2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one (PubChem CID 10684466) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one |
| PubChem CID | 10684466 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one |
| SMILES | COc1ccc(/C=N/n2sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C15H12N2O2S/c1-19-12-8-6-11(7-9-12)10-16-17-15(18)13-4-2-3-5-14(13)20-17/h2-10H,1H3/b16-10+ |
| InChIKey | GLQWNQHHMDKSNG-MHWRWJLKSA-N |
| XLogP | 2.95 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one?
The IUPAC name of 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one (CID 10684466) is 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one?
The canonical SMILES for 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one is COc1ccc(/C=N/n2sc3ccccc3c2=O)cc1.
What is the InChIKey of 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one?
The InChIKey is GLQWNQHHMDKSNG-MHWRWJLKSA-N. The full InChI is InChI=1S/C15H12N2O2S/c1-19-12-8-6-11(7-9-12)10-16-17-15(18)13-4-2-3-5-14(13)20-17/h2-10H,1H3/b16-10+.
What are the key properties of 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one?
2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one has a molecular weight of 284.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(4-methoxyphenyl)methylideneamino]-1,2-benzothiazol-3-one is sourced from PubChem (CID 10684466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).