C15H27NO4 — CID 10684550
methyl (2S)-4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate (PubChem CID 10684550) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl (2S)-4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate.
| Compound Name | methyl (2S)-4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate |
|---|---|
| PubChem CID | 10684550 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | methyl (2S)-4,4,5-trimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoate |
| SMILES | C=C(C)C(C)(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C15H27NO4/c1-10(2)15(6,7)9-11(12(17)19-8)16-13(18)20-14(3,4)5/h11H,1,9H2,2-8H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | DRQYPBSKDNXCHQ-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|