About (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate
(2-methyl-2-adamantyl) 2-pyridin-3-ylacetate (PubChem CID 10684552) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate |
| PubChem CID | 10684552 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate |
| SMILES | CC1(OC(=O)Cc2cccnc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H23NO2/c1-18(21-17(20)10-12-3-2-4-19-11-12)15-6-13-5-14(8-15)9-16(18)7-13/h2-4,11,13-16H,5-10H2,1H3 |
| InChIKey | DBGZAEICQRQMAF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate?
The IUPAC name of (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate (CID 10684552) is (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate.
What is the SMILES notation for (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate?
The canonical SMILES for (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate is CC1(OC(=O)Cc2cccnc2)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate?
The InChIKey is DBGZAEICQRQMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2/c1-18(21-17(20)10-12-3-2-4-19-11-12)15-6-13-5-14(8-15)9-16(18)7-13/h2-4,11,13-16H,5-10H2,1H3.
What are the key properties of (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate?
(2-methyl-2-adamantyl) 2-pyridin-3-ylacetate has a molecular weight of 285.39 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) 2-pyridin-3-ylacetate is sourced from PubChem (CID 10684552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).