C9H20BrNO2S — CID 106846746
N-(4-bromobutyl)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 106846746) has the molecular formula C9H20BrNO2S and a molecular weight of 286.24 g/mol. Its IUPAC name is N-(4-bromobutyl)-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | N-(4-bromobutyl)-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 106846746 |
| Molecular Formula | C9H20BrNO2S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(4-bromobutyl)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)NCCCCBr |
| InChI | InChI=1S/C9H20BrNO2S/c1-9(2,3)8-14(12,13)11-7-5-4-6-10/h11H,4-8H2,1-3H3 |
| InChIKey | CWVNKVMCVHMVSL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|