About (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one
(3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one (PubChem CID 1068483) has the molecular formula C23H18F3NO2
and a molecular weight of 397.40 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one.
Molecular Properties
| Compound Name | (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one |
| PubChem CID | 1068483 |
| Molecular Formula | C23H18F3NO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one |
| SMILES | Cn1c2ccccc2c2cc([C@@](O)(CC(=O)c3ccccc3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H18F3NO2/c1-27-19-10-6-5-9-17(19)18-13-16(11-12-20(18)27)22(29,23(24,25)26)14-21(28)15-7-3-2-4-8-15/h2-13,29H,14H2,1H3/t22-/m0/s1 |
| InChIKey | CSDSBLBTTNEXLM-QFIPXVFZSA-N |
| XLogP | 5.35 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one?
The IUPAC name of (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one (CID 1068483) is (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one.
What is the SMILES notation for (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one?
The canonical SMILES for (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one is Cn1c2ccccc2c2cc([C@@](O)(CC(=O)c3ccccc3)C(F)(F)F)ccc21.
What is the InChIKey of (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one?
The InChIKey is CSDSBLBTTNEXLM-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H18F3NO2/c1-27-19-10-6-5-9-17(19)18-13-16(11-12-20(18)27)22(29,23(24,25)26)14-21(28)15-7-3-2-4-8-15/h2-13,29H,14H2,1H3/t22-/m0/s1.
What are the key properties of (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one?
(3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one has a molecular weight of 397.40 g/mol, XLogP of 5.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4,4-trifluoro-3-hydroxy-3-(9-methylcarbazol-3-yl)-1-phenylbutan-1-one is sourced from PubChem (CID 1068483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).